C6H12ClNO2S — CID 45357993
ethyl (4R)-1,3-thiazolidine-4-carboxylate;hydrochloride (PubChem CID 45357993) has the molecular formula C6H12ClNO2S and a molecular weight of 197.69 g/mol. Its IUPAC name is ethyl (4R)-1,3-thiazolidine-4-carboxylate;hydrochloride.
| Compound Name | ethyl (4R)-1,3-thiazolidine-4-carboxylate;hydrochloride |
|---|---|
| PubChem CID | 45357993 |
| Molecular Formula | C6H12ClNO2S |
| Molecular Weight | 197.69 g/mol |
| Exact Mass | 197.03 |
| IUPAC Name | ethyl (4R)-1,3-thiazolidine-4-carboxylate;hydrochloride |
| SMILES | CCOC(=O)[C@@H]1CSCN1.Cl |
| InChI | InChI=1S/C6H11NO2S.ClH/c1-2-9-6(8)5-3-10-4-7-5;/h5,7H,2-4H2,1H3;1H/t5-;/m0./s1 |
| InChIKey | SQRLNYSSTHJCIU-JEDNCBNOSA-N |
| XLogP | 0.63 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.69 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |