C19H16BrFN4O3 — CID 45376309
[[5-bromo-7-[(4-fluorophenyl)methylcarbamoyl]-1,6-naphthyridin-8-yl]amino]methyl acetate (PubChem CID 45376309) has the molecular formula C19H16BrFN4O3 and a molecular weight of 447.26 g/mol. Its IUPAC name is [[5-bromo-7-[(4-fluorophenyl)methylcarbamoyl]-1,6-naphthyridin-8-yl]amino]methyl acetate.
| Compound Name | [[5-bromo-7-[(4-fluorophenyl)methylcarbamoyl]-1,6-naphthyridin-8-yl]amino]methyl acetate |
|---|---|
| PubChem CID | 45376309 |
| Molecular Formula | C19H16BrFN4O3 |
| Molecular Weight | 447.26 g/mol |
| Exact Mass | 446.04 |
| IUPAC Name | [[5-bromo-7-[(4-fluorophenyl)methylcarbamoyl]-1,6-naphthyridin-8-yl]amino]methyl acetate |
| SMILES | CC(=O)OCNc1c(C(=O)NCc2ccc(F)cc2)nc(Br)c2cccnc12 |
| InChI | InChI=1S/C19H16BrFN4O3/c1-11(26)28-10-24-16-15-14(3-2-8-22-15)18(20)25-17(16)19(27)23-9-12-4-6-13(21)7-5-12/h2-8,24H,9-10H2,1H3,(H,23,27) |
| InChIKey | JARZALKTSBJQGF-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 93.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.26 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|