C26H37N3O4S — CID 45378657
tert-butyl N-[1-[4-amino-3-[(4-propan-2-ylphenyl)sulfonylmethyl]phenyl]piperidin-4-yl]carbamate (PubChem CID 45378657) has the molecular formula C26H37N3O4S and a molecular weight of 487.67 g/mol. Its IUPAC name is tert-butyl N-[1-[4-amino-3-[(4-propan-2-ylphenyl)sulfonylmethyl]phenyl]piperidin-4-yl]carbamate.
| Compound Name | tert-butyl N-[1-[4-amino-3-[(4-propan-2-ylphenyl)sulfonylmethyl]phenyl]piperidin-4-yl]carbamate |
|---|---|
| PubChem CID | 45378657 |
| Molecular Formula | C26H37N3O4S |
| Molecular Weight | 487.67 g/mol |
| Exact Mass | 487.25 |
| IUPAC Name | tert-butyl N-[1-[4-amino-3-[(4-propan-2-ylphenyl)sulfonylmethyl]phenyl]piperidin-4-yl]carbamate |
| SMILES | CC(C)c1ccc(S(=O)(=O)Cc2cc(N3CCC(NC(=O)OC(C)(C)C)CC3)ccc2N)cc1 |
| InChI | InChI=1S/C26H37N3O4S/c1-18(2)19-6-9-23(10-7-19)34(31,32)17-20-16-22(8-11-24(20)27)29-14-12-21(13-15-29)28-25(30)33-26(3,4)5/h6-11,16,18,21H,12-15,17,27H2,1-5H3,(H,28,30) |
| InChIKey | ICDNSVHXVOGHOF-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.67 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|