C30H28N6O5 — CID 45378788
6-hydroxy-1-methyl-3-[1-[2-(4-morpholin-4-ylanilino)-2-oxoethyl]triazol-4-yl]-2-phenylindole-5-carboxylic acid (PubChem CID 45378788) has the molecular formula C30H28N6O5 and a molecular weight of 552.59 g/mol. Its IUPAC name is 6-hydroxy-1-methyl-3-[1-[2-(4-morpholin-4-ylanilino)-2-oxoethyl]triazol-4-yl]-2-phenylindole-5-carboxylic acid.
| Compound Name | 6-hydroxy-1-methyl-3-[1-[2-(4-morpholin-4-ylanilino)-2-oxoethyl]triazol-4-yl]-2-phenylindole-5-carboxylic acid |
|---|---|
| PubChem CID | 45378788 |
| Molecular Formula | C30H28N6O5 |
| Molecular Weight | 552.59 g/mol |
| Exact Mass | 552.21 |
| IUPAC Name | 6-hydroxy-1-methyl-3-[1-[2-(4-morpholin-4-ylanilino)-2-oxoethyl]triazol-4-yl]-2-phenylindole-5-carboxylic acid |
| SMILES | Cn1c(-c2ccccc2)c(-c2cn(CC(=O)Nc3ccc(N4CCOCC4)cc3)nn2)c2cc(C(=O)O)c(O)cc21 |
| InChI | InChI=1S/C30H28N6O5/c1-34-25-16-26(37)23(30(39)40)15-22(25)28(29(34)19-5-3-2-4-6-19)24-17-36(33-32-24)18-27(38)31-20-7-9-21(10-8-20)35-11-13-41-14-12-35/h2-10,15-17,37H,11-14,18H2,1H3,(H,31,38)(H,39,40) |
| InChIKey | WIYPLECRCPHRLR-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 134.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.59 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|