C20H16Cl2N6S3 — CID 45378914
2-[5-(6-carbamimidoyl-1,3-benzothiazol-2-yl)thiophen-2-yl]-1,3-benzothiazole-6-carboximidamide;dihydrochloride (PubChem CID 45378914) has the molecular formula C20H16Cl2N6S3 and a molecular weight of 507.50 g/mol. Its IUPAC name is 2-[5-(6-carbamimidoyl-1,3-benzothiazol-2-yl)thiophen-2-yl]-1,3-benzothiazole-6-carboximidamide;dihydrochloride.
| Compound Name | 2-[5-(6-carbamimidoyl-1,3-benzothiazol-2-yl)thiophen-2-yl]-1,3-benzothiazole-6-carboximidamide;dihydrochloride |
|---|---|
| PubChem CID | 45378914 |
| Molecular Formula | C20H16Cl2N6S3 |
| Molecular Weight | 507.50 g/mol |
| Exact Mass | 506.00 |
| IUPAC Name | 2-[5-(6-carbamimidoyl-1,3-benzothiazol-2-yl)thiophen-2-yl]-1,3-benzothiazole-6-carboximidamide;dihydrochloride |
| SMILES | Cl.Cl.[H]/N=C(\N)c1ccc2nc(-c3ccc(-c4nc5ccc(/C(N)=N/[H])cc5s4)s3)sc2c1 |
| InChI | InChI=1S/C20H14N6S3.2ClH/c21-17(22)9-1-3-11-15(7-9)28-19(25-11)13-5-6-14(27-13)20-26-12-4-2-10(18(23)24)8-16(12)29-20;;/h1-8H,(H3,21,22)(H3,23,24);2*1H |
| InChIKey | NYBICMIPLODIMK-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 125.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.50 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|