C26H35NO2 — CID 4538840
N-[1-(1-adamantyl)ethyl]-2-(6-methyl-5-propan-2-yl-1-benzofuran-3-yl)acetamide (PubChem CID 4538840) has the molecular formula C26H35NO2 and a molecular weight of 393.57 g/mol. Its IUPAC name is N-[1-(1-adamantyl)ethyl]-2-(6-methyl-5-propan-2-yl-1-benzofuran-3-yl)acetamide.
| Compound Name | N-[1-(1-adamantyl)ethyl]-2-(6-methyl-5-propan-2-yl-1-benzofuran-3-yl)acetamide |
|---|---|
| PubChem CID | 4538840 |
| Molecular Formula | C26H35NO2 |
| Molecular Weight | 393.57 g/mol |
| Exact Mass | 393.27 |
| IUPAC Name | N-[1-(1-adamantyl)ethyl]-2-(6-methyl-5-propan-2-yl-1-benzofuran-3-yl)acetamide |
| SMILES | Cc1cc2occ(CC(=O)NC(C)C34CC5CC(CC(C5)C3)C4)c2cc1C(C)C |
| InChI | InChI=1S/C26H35NO2/c1-15(2)22-10-23-21(14-29-24(23)5-16(22)3)9-25(28)27-17(4)26-11-18-6-19(12-26)8-20(7-18)13-26/h5,10,14-15,17-20H,6-9,11-13H2,1-4H3,(H,27,28) |
| InChIKey | XMCFNSMKMVJTSB-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.57 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |