C26H28N4O5 — CID 4546224
ethyl 4-[hydroxy-[1-(3-imidazol-1-ylpropyl)-4,5-dioxo-2-phenylpyrrolidin-3-ylidene]methyl]-3,5-dimethyl-1H-pyrrole-2-carboxylate (PubChem CID 4546224) has the molecular formula C26H28N4O5 and a molecular weight of 476.53 g/mol. Its IUPAC name is ethyl 4-[hydroxy-[1-(3-imidazol-1-ylpropyl)-4,5-dioxo-2-phenylpyrrolidin-3-ylidene]methyl]-3,5-dimethyl-1H-pyrrole-2-carboxylate.
| Compound Name | ethyl 4-[hydroxy-[1-(3-imidazol-1-ylpropyl)-4,5-dioxo-2-phenylpyrrolidin-3-ylidene]methyl]-3,5-dimethyl-1H-pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 4546224 |
| Molecular Formula | C26H28N4O5 |
| Molecular Weight | 476.53 g/mol |
| Exact Mass | 476.21 |
| IUPAC Name | ethyl 4-[hydroxy-[1-(3-imidazol-1-ylpropyl)-4,5-dioxo-2-phenylpyrrolidin-3-ylidene]methyl]-3,5-dimethyl-1H-pyrrole-2-carboxylate |
| SMILES | CCOC(=O)c1[nH]c(C)c(C(O)=C2C(=O)C(=O)N(CCCn3ccnc3)C2c2ccccc2)c1C |
| InChI | InChI=1S/C26H28N4O5/c1-4-35-26(34)21-16(2)19(17(3)28-21)23(31)20-22(18-9-6-5-7-10-18)30(25(33)24(20)32)13-8-12-29-14-11-27-15-29/h5-7,9-11,14-15,22,28,31H,4,8,12-13H2,1-3H3 |
| InChIKey | QBZBODGDLXHIST-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 117.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.53 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|