C26H27BrN4O5 — CID 98376256
ethyl 4-[(E)-[(2R)-2-(3-bromophenyl)-1-(3-imidazol-1-ylpropyl)-4,5-dioxopyrrolidin-3-ylidene]-hydroxymethyl]-3,5-dimethyl-1H-pyrrole-2-carboxylate (PubChem CID 98376256) has the molecular formula C26H27BrN4O5 and a molecular weight of 555.43 g/mol. Its IUPAC name is ethyl 4-[(E)-[(2R)-2-(3-bromophenyl)-1-(3-imidazol-1-ylpropyl)-4,5-dioxopyrrolidin-3-ylidene]-hydroxymethyl]-3,5-dimethyl-1H-pyrrole-2-carboxylate.
| Compound Name | ethyl 4-[(E)-[(2R)-2-(3-bromophenyl)-1-(3-imidazol-1-ylpropyl)-4,5-dioxopyrrolidin-3-ylidene]-hydroxymethyl]-3,5-dimethyl-1H-pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 98376256 |
| Molecular Formula | C26H27BrN4O5 |
| Molecular Weight | 555.43 g/mol |
| Exact Mass | 554.12 |
| IUPAC Name | ethyl 4-[(E)-[(2R)-2-(3-bromophenyl)-1-(3-imidazol-1-ylpropyl)-4,5-dioxopyrrolidin-3-ylidene]-hydroxymethyl]-3,5-dimethyl-1H-pyrrole-2-carboxylate |
| SMILES | CCOC(=O)c1[nH]c(C)c(/C(O)=C2\C(=O)C(=O)N(CCCn3ccnc3)[C@@H]2c2cccc(Br)c2)c1C |
| InChI | InChI=1S/C26H27BrN4O5/c1-4-36-26(35)21-15(2)19(16(3)29-21)23(32)20-22(17-7-5-8-18(27)13-17)31(25(34)24(20)33)11-6-10-30-12-9-28-14-30/h5,7-9,12-14,22,29,32H,4,6,10-11H2,1-3H3/b23-20+/t22-/m1/s1 |
| InChIKey | PYSDKHMVXIDNAC-IAMBOQNYSA-N |
| XLogP | 4.28 |
| TPSA | 117.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.43 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|