C29H39N3O6 — CID 4864287
ethyl 4-[[1-[3-(diethylamino)propyl]-2-(4-ethoxyphenyl)-4,5-dioxopyrrolidin-3-ylidene]-hydroxymethyl]-3,5-dimethyl-1H-pyrrole-2-carboxylate (PubChem CID 4864287) has the molecular formula C29H39N3O6 and a molecular weight of 525.65 g/mol. Its IUPAC name is ethyl 4-[[1-[3-(diethylamino)propyl]-2-(4-ethoxyphenyl)-4,5-dioxopyrrolidin-3-ylidene]-hydroxymethyl]-3,5-dimethyl-1H-pyrrole-2-carboxylate.
| Compound Name | ethyl 4-[[1-[3-(diethylamino)propyl]-2-(4-ethoxyphenyl)-4,5-dioxopyrrolidin-3-ylidene]-hydroxymethyl]-3,5-dimethyl-1H-pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 4864287 |
| Molecular Formula | C29H39N3O6 |
| Molecular Weight | 525.65 g/mol |
| Exact Mass | 525.28 |
| IUPAC Name | ethyl 4-[[1-[3-(diethylamino)propyl]-2-(4-ethoxyphenyl)-4,5-dioxopyrrolidin-3-ylidene]-hydroxymethyl]-3,5-dimethyl-1H-pyrrole-2-carboxylate |
| SMILES | CCOC(=O)c1[nH]c(C)c(C(O)=C2C(=O)C(=O)N(CCCN(CC)CC)C2c2ccc(OCC)cc2)c1C |
| InChI | InChI=1S/C29H39N3O6/c1-7-31(8-2)16-11-17-32-25(20-12-14-21(15-13-20)37-9-3)23(27(34)28(32)35)26(33)22-18(5)24(30-19(22)6)29(36)38-10-4/h12-15,25,30,33H,7-11,16-17H2,1-6H3 |
| InChIKey | JXSHPOYKQRXVJM-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 112.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.65 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|