C26H31Cl2N3O5 — CID 4864332
ethyl 4-[[2-(3,4-dichlorophenyl)-1-[2-(diethylamino)ethyl]-4,5-dioxopyrrolidin-3-ylidene]-hydroxymethyl]-3,5-dimethyl-1H-pyrrole-2-carboxylate (PubChem CID 4864332) has the molecular formula C26H31Cl2N3O5 and a molecular weight of 536.46 g/mol. Its IUPAC name is ethyl 4-[[2-(3,4-dichlorophenyl)-1-[2-(diethylamino)ethyl]-4,5-dioxopyrrolidin-3-ylidene]-hydroxymethyl]-3,5-dimethyl-1H-pyrrole-2-carboxylate.
| Compound Name | ethyl 4-[[2-(3,4-dichlorophenyl)-1-[2-(diethylamino)ethyl]-4,5-dioxopyrrolidin-3-ylidene]-hydroxymethyl]-3,5-dimethyl-1H-pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 4864332 |
| Molecular Formula | C26H31Cl2N3O5 |
| Molecular Weight | 536.46 g/mol |
| Exact Mass | 535.16 |
| IUPAC Name | ethyl 4-[[2-(3,4-dichlorophenyl)-1-[2-(diethylamino)ethyl]-4,5-dioxopyrrolidin-3-ylidene]-hydroxymethyl]-3,5-dimethyl-1H-pyrrole-2-carboxylate |
| SMILES | CCOC(=O)c1[nH]c(C)c(C(O)=C2C(=O)C(=O)N(CCN(CC)CC)C2c2ccc(Cl)c(Cl)c2)c1C |
| InChI | InChI=1S/C26H31Cl2N3O5/c1-6-30(7-2)11-12-31-22(16-9-10-17(27)18(28)13-16)20(24(33)25(31)34)23(32)19-14(4)21(29-15(19)5)26(35)36-8-3/h9-10,13,22,29,32H,6-8,11-12H2,1-5H3 |
| InChIKey | XTBJMZWQTOISCS-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 102.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.46 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|