C29H39N3O7 — CID 6221226
ethyl 4-[(E)-[1-[2-(diethylamino)ethyl]-2-(4-ethoxy-3-methoxyphenyl)-4,5-dioxopyrrolidin-3-ylidene]-hydroxymethyl]-3,5-dimethyl-1H-pyrrole-2-carboxylate (PubChem CID 6221226) has the molecular formula C29H39N3O7 and a molecular weight of 541.65 g/mol. Its IUPAC name is ethyl 4-[(E)-[1-[2-(diethylamino)ethyl]-2-(4-ethoxy-3-methoxyphenyl)-4,5-dioxopyrrolidin-3-ylidene]-hydroxymethyl]-3,5-dimethyl-1H-pyrrole-2-carboxylate.
| Compound Name | ethyl 4-[(E)-[1-[2-(diethylamino)ethyl]-2-(4-ethoxy-3-methoxyphenyl)-4,5-dioxopyrrolidin-3-ylidene]-hydroxymethyl]-3,5-dimethyl-1H-pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 6221226 |
| Molecular Formula | C29H39N3O7 |
| Molecular Weight | 541.65 g/mol |
| Exact Mass | 541.28 |
| IUPAC Name | ethyl 4-[(E)-[1-[2-(diethylamino)ethyl]-2-(4-ethoxy-3-methoxyphenyl)-4,5-dioxopyrrolidin-3-ylidene]-hydroxymethyl]-3,5-dimethyl-1H-pyrrole-2-carboxylate |
| SMILES | CCOC(=O)c1[nH]c(C)c(/C(O)=C2\C(=O)C(=O)N(CCN(CC)CC)C2c2ccc(OCC)c(OC)c2)c1C |
| InChI | InChI=1S/C29H39N3O7/c1-8-31(9-2)14-15-32-25(19-12-13-20(38-10-3)21(16-19)37-7)23(27(34)28(32)35)26(33)22-17(5)24(30-18(22)6)29(36)39-11-4/h12-13,16,25,30,33H,8-11,14-15H2,1-7H3/b26-23+ |
| InChIKey | FNHJEYCRZDQADT-WNAAXNPUSA-N |
| XLogP | 3.98 |
| TPSA | 121.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.65 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|