C31H39N3O2 — CID 45483251
4-[N-(1-benzylpiperidin-4-yl)-3-(1-hydroxyethyl)anilino]-N,N-diethylbenzamide (PubChem CID 45483251) has the molecular formula C31H39N3O2 and a molecular weight of 485.67 g/mol. Its IUPAC name is 4-[N-(1-benzylpiperidin-4-yl)-3-(1-hydroxyethyl)anilino]-N,N-diethylbenzamide.
| Compound Name | 4-[N-(1-benzylpiperidin-4-yl)-3-(1-hydroxyethyl)anilino]-N,N-diethylbenzamide |
|---|---|
| PubChem CID | 45483251 |
| Molecular Formula | C31H39N3O2 |
| Molecular Weight | 485.67 g/mol |
| Exact Mass | 485.30 |
| IUPAC Name | 4-[N-(1-benzylpiperidin-4-yl)-3-(1-hydroxyethyl)anilino]-N,N-diethylbenzamide |
| SMILES | CCN(CC)C(=O)c1ccc(N(c2cccc(C(C)O)c2)C2CCN(Cc3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C31H39N3O2/c1-4-33(5-2)31(36)26-14-16-28(17-15-26)34(30-13-9-12-27(22-30)24(3)35)29-18-20-32(21-19-29)23-25-10-7-6-8-11-25/h6-17,22,24,29,35H,4-5,18-21,23H2,1-3H3 |
| InChIKey | DBFHDFUSJJCBCW-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 47.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.67 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |