C30H37N3O2 — CID 45483286
4-[N-(1-benzylpiperidin-4-yl)-3-(hydroxymethyl)anilino]-N,N-diethylbenzamide (PubChem CID 45483286) has the molecular formula C30H37N3O2 and a molecular weight of 471.65 g/mol. Its IUPAC name is 4-[N-(1-benzylpiperidin-4-yl)-3-(hydroxymethyl)anilino]-N,N-diethylbenzamide.
| Compound Name | 4-[N-(1-benzylpiperidin-4-yl)-3-(hydroxymethyl)anilino]-N,N-diethylbenzamide |
|---|---|
| PubChem CID | 45483286 |
| Molecular Formula | C30H37N3O2 |
| Molecular Weight | 471.65 g/mol |
| Exact Mass | 471.29 |
| IUPAC Name | 4-[N-(1-benzylpiperidin-4-yl)-3-(hydroxymethyl)anilino]-N,N-diethylbenzamide |
| SMILES | CCN(CC)C(=O)c1ccc(N(c2cccc(CO)c2)C2CCN(Cc3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C30H37N3O2/c1-3-32(4-2)30(35)26-13-15-27(16-14-26)33(29-12-8-11-25(21-29)23-34)28-17-19-31(20-18-28)22-24-9-6-5-7-10-24/h5-16,21,28,34H,3-4,17-20,22-23H2,1-2H3 |
| InChIKey | RQYQDVZKXQROMJ-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 47.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.65 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |