C15H19NO3 — CID 45484089
(3S)-3-[(1S)-1-hydroxyethyl]-1-(4-phenylbutanoyl)azetidin-2-one (PubChem CID 45484089) has the molecular formula C15H19NO3 and a molecular weight of 261.32 g/mol. Its IUPAC name is (3S)-3-[(1S)-1-hydroxyethyl]-1-(4-phenylbutanoyl)azetidin-2-one.
| Compound Name | (3S)-3-[(1S)-1-hydroxyethyl]-1-(4-phenylbutanoyl)azetidin-2-one |
|---|---|
| PubChem CID | 45484089 |
| Molecular Formula | C15H19NO3 |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.14 |
| IUPAC Name | (3S)-3-[(1S)-1-hydroxyethyl]-1-(4-phenylbutanoyl)azetidin-2-one |
| SMILES | C[C@H](O)[C@@H]1CN(C(=O)CCCc2ccccc2)C1=O |
| InChI | InChI=1S/C15H19NO3/c1-11(17)13-10-16(15(13)19)14(18)9-5-8-12-6-3-2-4-7-12/h2-4,6-7,11,13,17H,5,8-10H2,1H3/t11-,13-/m0/s1 |
| InChIKey | NLWUCSQCTXKXJK-AAEUAGOBSA-N |
| XLogP | 1.38 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |