C22H22N2O2 — CID 45484199
[1-[(3-cyanophenyl)methyl]-2,2,4-trimethylquinolin-6-yl] acetate (PubChem CID 45484199) has the molecular formula C22H22N2O2 and a molecular weight of 346.43 g/mol. Its IUPAC name is [1-[(3-cyanophenyl)methyl]-2,2,4-trimethylquinolin-6-yl] acetate.
| Compound Name | [1-[(3-cyanophenyl)methyl]-2,2,4-trimethylquinolin-6-yl] acetate |
|---|---|
| PubChem CID | 45484199 |
| Molecular Formula | C22H22N2O2 |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.17 |
| IUPAC Name | [1-[(3-cyanophenyl)methyl]-2,2,4-trimethylquinolin-6-yl] acetate |
| SMILES | CC(=O)Oc1ccc2c(c1)C(C)=CC(C)(C)N2Cc1cccc(C#N)c1 |
| InChI | InChI=1S/C22H22N2O2/c1-15-12-22(3,4)24(14-18-7-5-6-17(10-18)13-23)21-9-8-19(11-20(15)21)26-16(2)25/h5-12H,14H2,1-4H3 |
| InChIKey | VQCLIAMLGDKAJK-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 53.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|