C19H18N2 — CID 142688351
3-(2,2,4-trimethylquinolin-1-yl)benzonitrile (PubChem CID 142688351) has the molecular formula C19H18N2 and a molecular weight of 274.37 g/mol. Its IUPAC name is 3-(2,2,4-trimethylquinolin-1-yl)benzonitrile.
| Compound Name | 3-(2,2,4-trimethylquinolin-1-yl)benzonitrile |
|---|---|
| PubChem CID | 142688351 |
| Molecular Formula | C19H18N2 |
| Molecular Weight | 274.37 g/mol |
| Exact Mass | 274.15 |
| IUPAC Name | 3-(2,2,4-trimethylquinolin-1-yl)benzonitrile |
| SMILES | CC1=CC(C)(C)N(c2cccc(C#N)c2)c2ccccc21 |
| InChI | InChI=1S/C19H18N2/c1-14-12-19(2,3)21(18-10-5-4-9-17(14)18)16-8-6-7-15(11-16)13-20/h4-12H,1-3H3 |
| InChIKey | XPMWZXWVCSWPEY-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.37 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |