C33H38N2 — CID 3090972
1,2,2,4-tetramethyl-6-[phenyl-(1,2,2,4-tetramethylquinolin-6-yl)methyl]quinoline (PubChem CID 3090972) has the molecular formula C33H38N2 and a molecular weight of 462.68 g/mol. Its IUPAC name is 1,2,2,4-tetramethyl-6-[phenyl-(1,2,2,4-tetramethylquinolin-6-yl)methyl]quinoline.
| Compound Name | 1,2,2,4-tetramethyl-6-[phenyl-(1,2,2,4-tetramethylquinolin-6-yl)methyl]quinoline |
|---|---|
| PubChem CID | 3090972 |
| Molecular Formula | C33H38N2 |
| Molecular Weight | 462.68 g/mol |
| Exact Mass | 462.30 |
| IUPAC Name | 1,2,2,4-tetramethyl-6-[phenyl-(1,2,2,4-tetramethylquinolin-6-yl)methyl]quinoline |
| SMILES | CC1=CC(C)(C)N(C)c2ccc(C(c3ccccc3)c3ccc4c(c3)C(C)=CC(C)(C)N4C)cc21 |
| InChI | InChI=1S/C33H38N2/c1-22-20-32(3,4)34(7)29-16-14-25(18-27(22)29)31(24-12-10-9-11-13-24)26-15-17-30-28(19-26)23(2)21-33(5,6)35(30)8/h9-21,31H,1-8H3 |
| InChIKey | DYEPMDSJNIXHHO-UHFFFAOYSA-N |
| XLogP | 8.13 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.68 |
| LogP ≤ 5 | 8.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|