About 3-[(8-acetyl-2,2-difluoro-3-oxo-1,4-benzoxazin-4-yl)methyl]benzonitrile
3-[(8-acetyl-2,2-difluoro-3-oxo-1,4-benzoxazin-4-yl)methyl]benzonitrile (PubChem CID 123763589) has the molecular formula C18H12F2N2O3
and a molecular weight of 342.30 g/mol. Its IUPAC name is 3-[(8-acetyl-2,2-difluoro-3-oxo-1,4-benzoxazin-4-yl)methyl]benzonitrile.
Molecular Properties
| Compound Name | 3-[(8-acetyl-2,2-difluoro-3-oxo-1,4-benzoxazin-4-yl)methyl]benzonitrile |
| PubChem CID | 123763589 |
| Molecular Formula | C18H12F2N2O3 |
| Molecular Weight | 342.30 g/mol |
| Exact Mass | 342.08 |
| IUPAC Name | 3-[(8-acetyl-2,2-difluoro-3-oxo-1,4-benzoxazin-4-yl)methyl]benzonitrile |
| SMILES | CC(=O)c1cccc2c1OC(F)(F)C(=O)N2Cc1cccc(C#N)c1 |
| InChI | InChI=1S/C18H12F2N2O3/c1-11(23)14-6-3-7-15-16(14)25-18(19,20)17(24)22(15)10-13-5-2-4-12(8-13)9-21/h2-8H,10H2,1H3 |
| InChIKey | XHSKMBIVRUDQAI-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 70.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 342.30 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[(8-acetyl-2,2-difluoro-3-oxo-1,4-benzoxazin-4-yl)methyl]benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(8-acetyl-2,2-difluoro-3-oxo-1,4-benzoxazin-4-yl)methyl]benzonitrile?
The IUPAC name of 3-[(8-acetyl-2,2-difluoro-3-oxo-1,4-benzoxazin-4-yl)methyl]benzonitrile (CID 123763589) is 3-[(8-acetyl-2,2-difluoro-3-oxo-1,4-benzoxazin-4-yl)methyl]benzonitrile.
What is the SMILES notation for 3-[(8-acetyl-2,2-difluoro-3-oxo-1,4-benzoxazin-4-yl)methyl]benzonitrile?
The canonical SMILES for 3-[(8-acetyl-2,2-difluoro-3-oxo-1,4-benzoxazin-4-yl)methyl]benzonitrile is CC(=O)c1cccc2c1OC(F)(F)C(=O)N2Cc1cccc(C#N)c1.
What is the InChIKey of 3-[(8-acetyl-2,2-difluoro-3-oxo-1,4-benzoxazin-4-yl)methyl]benzonitrile?
The InChIKey is XHSKMBIVRUDQAI-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H12F2N2O3/c1-11(23)14-6-3-7-15-16(14)25-18(19,20)17(24)22(15)10-13-5-2-4-12(8-13)9-21/h2-8H,10H2,1H3.
What are the key properties of 3-[(8-acetyl-2,2-difluoro-3-oxo-1,4-benzoxazin-4-yl)methyl]benzonitrile?
3-[(8-acetyl-2,2-difluoro-3-oxo-1,4-benzoxazin-4-yl)methyl]benzonitrile has a molecular weight of 342.30 g/mol, XLogP of 3.28, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(8-acetyl-2,2-difluoro-3-oxo-1,4-benzoxazin-4-yl)methyl]benzonitrile is sourced from PubChem (CID 123763589), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).