C17H19F3N4O2 — CID 45484904
3-methyl-6-piperazin-1-yl-2-[[4-(trifluoromethyl)phenoxy]methyl]pyrimidin-4-one (PubChem CID 45484904) has the molecular formula C17H19F3N4O2 and a molecular weight of 368.36 g/mol. Its IUPAC name is 3-methyl-6-piperazin-1-yl-2-[[4-(trifluoromethyl)phenoxy]methyl]pyrimidin-4-one.
| Compound Name | 3-methyl-6-piperazin-1-yl-2-[[4-(trifluoromethyl)phenoxy]methyl]pyrimidin-4-one |
|---|---|
| PubChem CID | 45484904 |
| Molecular Formula | C17H19F3N4O2 |
| Molecular Weight | 368.36 g/mol |
| Exact Mass | 368.15 |
| IUPAC Name | 3-methyl-6-piperazin-1-yl-2-[[4-(trifluoromethyl)phenoxy]methyl]pyrimidin-4-one |
| SMILES | Cn1c(COc2ccc(C(F)(F)F)cc2)nc(N2CCNCC2)cc1=O |
| InChI | InChI=1S/C17H19F3N4O2/c1-23-15(11-26-13-4-2-12(3-5-13)17(18,19)20)22-14(10-16(23)25)24-8-6-21-7-9-24/h2-5,10,21H,6-9,11H2,1H3 |
| InChIKey | WPOAOOKQYJNWHY-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.36 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |