About 7-bromoquinolin-2-amine
7-bromoquinolin-2-amine (PubChem CID 45489778) has the molecular formula C9H7BrN2
and a molecular weight of 223.07 g/mol. Its IUPAC name is 7-bromoquinolin-2-amine.
Molecular Properties
| Compound Name | 7-bromoquinolin-2-amine |
| PubChem CID | 45489778 |
| Molecular Formula | C9H7BrN2 |
| Molecular Weight | 223.07 g/mol |
| Exact Mass | 221.98 |
| IUPAC Name | 7-bromoquinolin-2-amine |
| SMILES | Nc1ccc2ccc(Br)cc2n1 |
| InChI | InChI=1S/C9H7BrN2/c10-7-3-1-6-2-4-9(11)12-8(6)5-7/h1-5H,(H2,11,12) |
| InChIKey | VKPJHDQCHZUELB-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.07 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 7-bromoquinolin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-bromoquinolin-2-amine?
The IUPAC name of 7-bromoquinolin-2-amine (CID 45489778) is 7-bromoquinolin-2-amine.
What is the SMILES notation for 7-bromoquinolin-2-amine?
The canonical SMILES for 7-bromoquinolin-2-amine is Nc1ccc2ccc(Br)cc2n1.
What is the InChIKey of 7-bromoquinolin-2-amine?
The InChIKey is VKPJHDQCHZUELB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7BrN2/c10-7-3-1-6-2-4-9(11)12-8(6)5-7/h1-5H,(H2,11,12).
What are the key properties of 7-bromoquinolin-2-amine?
7-bromoquinolin-2-amine has a molecular weight of 223.07 g/mol, XLogP of 2.58, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-bromoquinolin-2-amine is sourced from PubChem (CID 45489778), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).