C17H14N2O4 — CID 45492489
N-(furan-2-ylmethyl)-N'-(5-hydroxynaphthalen-1-yl)oxamide (PubChem CID 45492489) has the molecular formula C17H14N2O4 and a molecular weight of 310.31 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-N'-(5-hydroxynaphthalen-1-yl)oxamide.
| Compound Name | N-(furan-2-ylmethyl)-N'-(5-hydroxynaphthalen-1-yl)oxamide |
|---|---|
| PubChem CID | 45492489 |
| Molecular Formula | C17H14N2O4 |
| Molecular Weight | 310.31 g/mol |
| Exact Mass | 310.10 |
| IUPAC Name | N-(furan-2-ylmethyl)-N'-(5-hydroxynaphthalen-1-yl)oxamide |
| SMILES | O=C(NCc1ccco1)C(=O)Nc1cccc2c(O)cccc12 |
| InChI | InChI=1S/C17H14N2O4/c20-15-8-2-5-12-13(15)6-1-7-14(12)19-17(22)16(21)18-10-11-4-3-9-23-11/h1-9,20H,10H2,(H,18,21)(H,19,22) |
| InChIKey | CZJKMIYQOQLQMS-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 91.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.31 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|