C19H21N3O5S — CID 45494621
N'-[3-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]-N-[2-(4-hydroxyphenyl)ethyl]oxamide (PubChem CID 45494621) has the molecular formula C19H21N3O5S and a molecular weight of 403.46 g/mol. Its IUPAC name is N'-[3-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]-N-[2-(4-hydroxyphenyl)ethyl]oxamide.
| Compound Name | N'-[3-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]-N-[2-(4-hydroxyphenyl)ethyl]oxamide |
|---|---|
| PubChem CID | 45494621 |
| Molecular Formula | C19H21N3O5S |
| Molecular Weight | 403.46 g/mol |
| Exact Mass | 403.12 |
| IUPAC Name | N'-[3-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]-N-[2-(4-hydroxyphenyl)ethyl]oxamide |
| SMILES | O=C(NCCc1ccc(O)cc1)C(=O)Nc1cccc(N2CCCS2(=O)=O)c1 |
| InChI | InChI=1S/C19H21N3O5S/c23-17-7-5-14(6-8-17)9-10-20-18(24)19(25)21-15-3-1-4-16(13-15)22-11-2-12-28(22,26)27/h1,3-8,13,23H,2,9-12H2,(H,20,24)(H,21,25) |
| InChIKey | UMAWTPIEBFQLBI-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 115.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.46 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|