C19H19N5O4S — CID 51048789
N-(1H-benzimidazol-2-ylmethyl)-N'-[3-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]oxamide (PubChem CID 51048789) has the molecular formula C19H19N5O4S and a molecular weight of 413.46 g/mol. Its IUPAC name is N-(1H-benzimidazol-2-ylmethyl)-N'-[3-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]oxamide.
| Compound Name | N-(1H-benzimidazol-2-ylmethyl)-N'-[3-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]oxamide |
|---|---|
| PubChem CID | 51048789 |
| Molecular Formula | C19H19N5O4S |
| Molecular Weight | 413.46 g/mol |
| Exact Mass | 413.12 |
| IUPAC Name | N-(1H-benzimidazol-2-ylmethyl)-N'-[3-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]oxamide |
| SMILES | O=C(NCc1nc2ccccc2[nH]1)C(=O)Nc1cccc(N2CCCS2(=O)=O)c1 |
| InChI | InChI=1S/C19H19N5O4S/c25-18(20-12-17-22-15-7-1-2-8-16(15)23-17)19(26)21-13-5-3-6-14(11-13)24-9-4-10-29(24,27)28/h1-3,5-8,11H,4,9-10,12H2,(H,20,25)(H,21,26)(H,22,23) |
| InChIKey | PTLJXXRNBSCXIU-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 124.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.46 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|