C9H11N4O5+ — CID 4555041
1-[4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-2,4-dioxopyrimidine-5-diazonium (PubChem CID 4555041) has the molecular formula C9H11N4O5+ and a molecular weight of 255.21 g/mol. Its IUPAC name is 1-[4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-2,4-dioxopyrimidine-5-diazonium.
| Compound Name | 1-[4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-2,4-dioxopyrimidine-5-diazonium |
|---|---|
| PubChem CID | 4555041 |
| Molecular Formula | C9H11N4O5+ |
| Molecular Weight | 255.21 g/mol |
| Exact Mass | 255.07 |
| IUPAC Name | 1-[4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-2,4-dioxopyrimidine-5-diazonium |
| SMILES | N#[N+]c1cn(C2CC(O)C(CO)O2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C9H10N4O5/c10-12-4-2-13(9(17)11-8(4)16)7-1-5(15)6(3-14)18-7/h2,5-7,14-15H,1,3H2/p+1 |
| InChIKey | TWFLFRCNAHSZMS-UHFFFAOYSA-O |
| XLogP | -1.34 |
| TPSA | 132.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.21 |
| LogP ≤ 5 | -1.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Azo_group', 'substructure': 'N/A'} |
|---|