C10H11N3O5 — CID 155642388
1-[(2R,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-isocyanopyrimidine-2,4-dione (PubChem CID 155642388) has the molecular formula C10H11N3O5 and a molecular weight of 253.21 g/mol. Its IUPAC name is 1-[(2R,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-isocyanopyrimidine-2,4-dione.
| Compound Name | 1-[(2R,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-isocyanopyrimidine-2,4-dione |
|---|---|
| PubChem CID | 155642388 |
| Molecular Formula | C10H11N3O5 |
| Molecular Weight | 253.21 g/mol |
| Exact Mass | 253.07 |
| IUPAC Name | 1-[(2R,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-isocyanopyrimidine-2,4-dione |
| SMILES | [C-]#[N+]c1cn([C@H]2CC(O)[C@@H](CO)O2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C10H11N3O5/c1-11-5-3-13(10(17)12-9(5)16)8-2-6(15)7(4-14)18-8/h3,6-8,14-15H,2,4H2,(H,12,16,17)/t6?,7-,8-/m1/s1 |
| InChIKey | NVYHSOZNNNPSRR-SPDVFEMOSA-N |
| XLogP | -1.27 |
| TPSA | 108.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.21 |
| LogP ≤ 5 | -1.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|