C10H11N3O4 — CID 58308003
1-[(2R,5R)-5-(deuteriomethyl)-4-hydroxyoxolan-2-yl]-5-isocyanopyrimidine-2,4-dione (PubChem CID 58308003) has the molecular formula C10H11N3O4 and a molecular weight of 238.22 g/mol. Its IUPAC name is 1-[(2R,5R)-5-(deuteriomethyl)-4-hydroxyoxolan-2-yl]-5-isocyanopyrimidine-2,4-dione.
| Compound Name | 1-[(2R,5R)-5-(deuteriomethyl)-4-hydroxyoxolan-2-yl]-5-isocyanopyrimidine-2,4-dione |
|---|---|
| PubChem CID | 58308003 |
| Molecular Formula | C10H11N3O4 |
| Molecular Weight | 238.22 g/mol |
| Exact Mass | 238.08 |
| IUPAC Name | 1-[(2R,5R)-5-(deuteriomethyl)-4-hydroxyoxolan-2-yl]-5-isocyanopyrimidine-2,4-dione |
| SMILES | [2H]C[C@H]1O[C@@H](n2cc([N+]#[C-])c(=O)[nH]c2=O)CC1O |
| InChI | InChI=1S/C10H11N3O4/c1-5-7(14)3-8(17-5)13-4-6(11-2)9(15)12-10(13)16/h4-5,7-8,14H,3H2,1H3,(H,12,15,16)/t5-,7?,8-/m1/s1/i1D |
| InChIKey | BRHJCQOUXDKBNM-HLCTYAFNSA-N |
| XLogP | -0.24 |
| TPSA | 88.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.22 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|