C17H12FN3O4 — CID 4558707
N-[(5-fluoro-2-hydroxy-1H-indol-3-yl)imino]-2,3-dihydro-1,4-benzodioxine-3-carboxamide (PubChem CID 4558707) has the molecular formula C17H12FN3O4 and a molecular weight of 341.30 g/mol. Its IUPAC name is N-[(5-fluoro-2-hydroxy-1H-indol-3-yl)imino]-2,3-dihydro-1,4-benzodioxine-3-carboxamide.
| Compound Name | N-[(5-fluoro-2-hydroxy-1H-indol-3-yl)imino]-2,3-dihydro-1,4-benzodioxine-3-carboxamide |
|---|---|
| PubChem CID | 4558707 |
| Molecular Formula | C17H12FN3O4 |
| Molecular Weight | 341.30 g/mol |
| Exact Mass | 341.08 |
| IUPAC Name | N-[(5-fluoro-2-hydroxy-1H-indol-3-yl)imino]-2,3-dihydro-1,4-benzodioxine-3-carboxamide |
| SMILES | O=C(/N=N/c1c(O)[nH]c2ccc(F)cc12)C1COc2ccccc2O1 |
| InChI | InChI=1S/C17H12FN3O4/c18-9-5-6-11-10(7-9)15(17(23)19-11)20-21-16(22)14-8-24-12-3-1-2-4-13(12)25-14/h1-7,14,19,23H,8H2/b21-20+ |
| InChIKey | LNUJHRYWQNZNCN-QZQOTICOSA-N |
| XLogP | 3.46 |
| TPSA | 96.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.30 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|