C28H29N3O4S2 — CID 4560514
4-[benzyl(tert-butyl)sulfamoyl]-N-[4-(3-methoxyphenyl)-1,3-thiazol-2-yl]benzamide (PubChem CID 4560514) has the molecular formula C28H29N3O4S2 and a molecular weight of 535.69 g/mol. Its IUPAC name is 4-[benzyl(tert-butyl)sulfamoyl]-N-[4-(3-methoxyphenyl)-1,3-thiazol-2-yl]benzamide.
| Compound Name | 4-[benzyl(tert-butyl)sulfamoyl]-N-[4-(3-methoxyphenyl)-1,3-thiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 4560514 |
| Molecular Formula | C28H29N3O4S2 |
| Molecular Weight | 535.69 g/mol |
| Exact Mass | 535.16 |
| IUPAC Name | 4-[benzyl(tert-butyl)sulfamoyl]-N-[4-(3-methoxyphenyl)-1,3-thiazol-2-yl]benzamide |
| SMILES | COc1cccc(-c2csc(NC(=O)c3ccc(S(=O)(=O)N(Cc4ccccc4)C(C)(C)C)cc3)n2)c1 |
| InChI | InChI=1S/C28H29N3O4S2/c1-28(2,3)31(18-20-9-6-5-7-10-20)37(33,34)24-15-13-21(14-16-24)26(32)30-27-29-25(19-36-27)22-11-8-12-23(17-22)35-4/h5-17,19H,18H2,1-4H3,(H,29,30,32) |
| InChIKey | SIVZFJDSBREVCU-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.69 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |