C22H18N2O2 — CID 4564262
4-oxo-N,1,2-triphenylazetidine-2-carboxamide (PubChem CID 4564262) has the molecular formula C22H18N2O2 and a molecular weight of 342.40 g/mol. Its IUPAC name is 4-oxo-N,1,2-triphenylazetidine-2-carboxamide.
| Compound Name | 4-oxo-N,1,2-triphenylazetidine-2-carboxamide |
|---|---|
| PubChem CID | 4564262 |
| Molecular Formula | C22H18N2O2 |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.14 |
| IUPAC Name | 4-oxo-N,1,2-triphenylazetidine-2-carboxamide |
| SMILES | O=C1CC(C(=O)Nc2ccccc2)(c2ccccc2)N1c1ccccc1 |
| InChI | InChI=1S/C22H18N2O2/c25-20-16-22(17-10-4-1-5-11-17,24(20)19-14-8-3-9-15-19)21(26)23-18-12-6-2-7-13-18/h1-15H,16H2,(H,23,26) |
| InChIKey | NMMITAOSKDSEIR-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |