C24H21ClN2O2 — CID 3809536
2-(2-chlorophenyl)-N,1-bis(4-methylphenyl)-4-oxoazetidine-2-carboxamide (PubChem CID 3809536) has the molecular formula C24H21ClN2O2 and a molecular weight of 404.90 g/mol. Its IUPAC name is 2-(2-chlorophenyl)-N,1-bis(4-methylphenyl)-4-oxoazetidine-2-carboxamide.
| Compound Name | 2-(2-chlorophenyl)-N,1-bis(4-methylphenyl)-4-oxoazetidine-2-carboxamide |
|---|---|
| PubChem CID | 3809536 |
| Molecular Formula | C24H21ClN2O2 |
| Molecular Weight | 404.90 g/mol |
| Exact Mass | 404.13 |
| IUPAC Name | 2-(2-chlorophenyl)-N,1-bis(4-methylphenyl)-4-oxoazetidine-2-carboxamide |
| SMILES | Cc1ccc(NC(=O)C2(c3ccccc3Cl)CC(=O)N2c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C24H21ClN2O2/c1-16-7-11-18(12-8-16)26-23(29)24(20-5-3-4-6-21(20)25)15-22(28)27(24)19-13-9-17(2)10-14-19/h3-14H,15H2,1-2H3,(H,26,29) |
| InChIKey | AHLOXCJMBSNUES-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.90 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |