C18H18N2O4 — CID 4564609
N-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)-2-ethoxybenzamide (PubChem CID 4564609) has the molecular formula C18H18N2O4 and a molecular weight of 326.35 g/mol. Its IUPAC name is N-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)-2-ethoxybenzamide.
| Compound Name | N-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)-2-ethoxybenzamide |
|---|---|
| PubChem CID | 4564609 |
| Molecular Formula | C18H18N2O4 |
| Molecular Weight | 326.35 g/mol |
| Exact Mass | 326.13 |
| IUPAC Name | N-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)-2-ethoxybenzamide |
| SMILES | CCOc1ccccc1C(=O)NN1C(=O)C2C3C=CC(C3)C2C1=O |
| InChI | InChI=1S/C18H18N2O4/c1-2-24-13-6-4-3-5-12(13)16(21)19-20-17(22)14-10-7-8-11(9-10)15(14)18(20)23/h3-8,10-11,14-15H,2,9H2,1H3,(H,19,21) |
| InChIKey | KMBNQASMEILRAN-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.35 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|