C18H12Cl6N2O4 — CID 99723267
2-ethoxy-N-[(1R,2R,6R,7R)-1,7,8,9,10,10-hexachloro-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]benzamide (PubChem CID 99723267) has the molecular formula C18H12Cl6N2O4 and a molecular weight of 533.02 g/mol. Its IUPAC name is 2-ethoxy-N-[(1R,2R,6R,7R)-1,7,8,9,10,10-hexachloro-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]benzamide.
| Compound Name | 2-ethoxy-N-[(1R,2R,6R,7R)-1,7,8,9,10,10-hexachloro-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]benzamide |
|---|---|
| PubChem CID | 99723267 |
| Molecular Formula | C18H12Cl6N2O4 |
| Molecular Weight | 533.02 g/mol |
| Exact Mass | 529.89 |
| IUPAC Name | 2-ethoxy-N-[(1R,2R,6R,7R)-1,7,8,9,10,10-hexachloro-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]benzamide |
| SMILES | CCOc1ccccc1C(=O)NN1C(=O)[C@H]2[C@H](C1=O)[C@@]1(Cl)C(Cl)=C(Cl)[C@@]2(Cl)C1(Cl)Cl |
| InChI | InChI=1S/C18H12Cl6N2O4/c1-2-30-8-6-4-3-5-7(8)13(27)25-26-14(28)9-10(15(26)29)17(22)12(20)11(19)16(9,21)18(17,23)24/h3-6,9-10H,2H2,1H3,(H,25,27)/t9-,10-,16-,17-/m1/s1 |
| InChIKey | YZXIHVUTMKKRBV-HPLPCWARSA-N |
| XLogP | 4.18 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.02 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|