C20H16N2O4 — CID 124775731
N-[(1R,2R,6R,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]-3-hydroxynaphthalene-2-carboxamide (PubChem CID 124775731) has the molecular formula C20H16N2O4 and a molecular weight of 348.36 g/mol. Its IUPAC name is N-[(1R,2R,6R,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]-3-hydroxynaphthalene-2-carboxamide.
| Compound Name | N-[(1R,2R,6R,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]-3-hydroxynaphthalene-2-carboxamide |
|---|---|
| PubChem CID | 124775731 |
| Molecular Formula | C20H16N2O4 |
| Molecular Weight | 348.36 g/mol |
| Exact Mass | 348.11 |
| IUPAC Name | N-[(1R,2R,6R,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]-3-hydroxynaphthalene-2-carboxamide |
| SMILES | O=C(NN1C(=O)[C@H]2[C@H](C1=O)[C@H]1C=C[C@H]2C1)c1cc2ccccc2cc1O |
| InChI | InChI=1S/C20H16N2O4/c23-15-9-11-4-2-1-3-10(11)8-14(15)18(24)21-22-19(25)16-12-5-6-13(7-12)17(16)20(22)26/h1-6,8-9,12-13,16-17,23H,7H2,(H,21,24)/t12-,13-,16+,17+/m0/s1 |
| InChIKey | INUZZPZUZVKGCF-WRFANHODSA-N |
| XLogP | 2.00 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.36 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|