C14H14N2O2 — CID 4566093
4-phenyl-1,3,4,6,7,8-hexahydroquinazoline-2,5-dione (PubChem CID 4566093) has the molecular formula C14H14N2O2 and a molecular weight of 242.28 g/mol. Its IUPAC name is 4-phenyl-1,3,4,6,7,8-hexahydroquinazoline-2,5-dione.
| Compound Name | 4-phenyl-1,3,4,6,7,8-hexahydroquinazoline-2,5-dione |
|---|---|
| PubChem CID | 4566093 |
| Molecular Formula | C14H14N2O2 |
| Molecular Weight | 242.28 g/mol |
| Exact Mass | 242.11 |
| IUPAC Name | 4-phenyl-1,3,4,6,7,8-hexahydroquinazoline-2,5-dione |
| SMILES | O=C1NC2=C(C(=O)CCC2)C(c2ccccc2)N1 |
| InChI | InChI=1S/C14H14N2O2/c17-11-8-4-7-10-12(11)13(16-14(18)15-10)9-5-2-1-3-6-9/h1-3,5-6,13H,4,7-8H2,(H2,15,16,18) |
| InChIKey | CWJIPAGNXXXBNP-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.28 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |