C18H19N4O2S+ — CID 4567199
N-(2-ethoxyphenyl)-2-[(2-phenyl-1H-1,2,4-triazol-2-ium-3-yl)sulfanyl]acetamide (PubChem CID 4567199) has the molecular formula C18H19N4O2S+ and a molecular weight of 355.44 g/mol. Its IUPAC name is N-(2-ethoxyphenyl)-2-[(2-phenyl-1H-1,2,4-triazol-2-ium-3-yl)sulfanyl]acetamide.
| Compound Name | N-(2-ethoxyphenyl)-2-[(2-phenyl-1H-1,2,4-triazol-2-ium-3-yl)sulfanyl]acetamide |
|---|---|
| PubChem CID | 4567199 |
| Molecular Formula | C18H19N4O2S+ |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.12 |
| IUPAC Name | N-(2-ethoxyphenyl)-2-[(2-phenyl-1H-1,2,4-triazol-2-ium-3-yl)sulfanyl]acetamide |
| SMILES | CCOc1ccccc1NC(=O)CSc1nc[nH][n+]1-c1ccccc1 |
| InChI | InChI=1S/C18H18N4O2S/c1-2-24-16-11-7-6-10-15(16)21-17(23)12-25-18-19-13-20-22(18)14-8-4-3-5-9-14/h3-11,13H,2,12H2,1H3,(H,21,23)/p+1 |
| InChIKey | XHPRYCSLBBLKOT-UHFFFAOYSA-O |
| XLogP | 2.82 |
| TPSA | 70.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|