C25H31N3O6 — CID 4569528
N'-[5-(3,4-dihydro-1H-isoquinolin-2-yl)-3-methyl-5-oxopentanoyl]-3,4,5-trimethoxybenzohydrazide (PubChem CID 4569528) has the molecular formula C25H31N3O6 and a molecular weight of 469.54 g/mol. Its IUPAC name is N'-[5-(3,4-dihydro-1H-isoquinolin-2-yl)-3-methyl-5-oxopentanoyl]-3,4,5-trimethoxybenzohydrazide.
| Compound Name | N'-[5-(3,4-dihydro-1H-isoquinolin-2-yl)-3-methyl-5-oxopentanoyl]-3,4,5-trimethoxybenzohydrazide |
|---|---|
| PubChem CID | 4569528 |
| Molecular Formula | C25H31N3O6 |
| Molecular Weight | 469.54 g/mol |
| Exact Mass | 469.22 |
| IUPAC Name | N'-[5-(3,4-dihydro-1H-isoquinolin-2-yl)-3-methyl-5-oxopentanoyl]-3,4,5-trimethoxybenzohydrazide |
| SMILES | COc1cc(C(=O)NNC(=O)CC(C)CC(=O)N2CCc3ccccc3C2)cc(OC)c1OC |
| InChI | InChI=1S/C25H31N3O6/c1-16(12-23(30)28-10-9-17-7-5-6-8-18(17)15-28)11-22(29)26-27-25(31)19-13-20(32-2)24(34-4)21(14-19)33-3/h5-8,13-14,16H,9-12,15H2,1-4H3,(H,26,29)(H,27,31) |
| InChIKey | QIQUSLKLSIMDGE-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 106.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.54 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|