C23H35N3O6 — CID 5219851
N'-[5-(3,5-dimethylpiperidin-1-yl)-3-methyl-5-oxopentanoyl]-3,4,5-trimethoxybenzohydrazide (PubChem CID 5219851) has the molecular formula C23H35N3O6 and a molecular weight of 449.55 g/mol. Its IUPAC name is N'-[5-(3,5-dimethylpiperidin-1-yl)-3-methyl-5-oxopentanoyl]-3,4,5-trimethoxybenzohydrazide.
| Compound Name | N'-[5-(3,5-dimethylpiperidin-1-yl)-3-methyl-5-oxopentanoyl]-3,4,5-trimethoxybenzohydrazide |
|---|---|
| PubChem CID | 5219851 |
| Molecular Formula | C23H35N3O6 |
| Molecular Weight | 449.55 g/mol |
| Exact Mass | 449.25 |
| IUPAC Name | N'-[5-(3,5-dimethylpiperidin-1-yl)-3-methyl-5-oxopentanoyl]-3,4,5-trimethoxybenzohydrazide |
| SMILES | COc1cc(C(=O)NNC(=O)CC(C)CC(=O)N2CC(C)CC(C)C2)cc(OC)c1OC |
| InChI | InChI=1S/C23H35N3O6/c1-14(9-21(28)26-12-15(2)7-16(3)13-26)8-20(27)24-25-23(29)17-10-18(30-4)22(32-6)19(11-17)31-5/h10-11,14-16H,7-9,12-13H2,1-6H3,(H,24,27)(H,25,29) |
| InChIKey | MQDSKDRGUGLEHH-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 106.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.55 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|