C22H26N2O4 — CID 4581452
N-[1-(1,3-benzodioxol-5-yl)ethylideneamino]-2-hydroxy-3,5-di(propan-2-yl)benzamide (PubChem CID 4581452) has the molecular formula C22H26N2O4 and a molecular weight of 382.46 g/mol. Its IUPAC name is N-[1-(1,3-benzodioxol-5-yl)ethylideneamino]-2-hydroxy-3,5-di(propan-2-yl)benzamide.
| Compound Name | N-[1-(1,3-benzodioxol-5-yl)ethylideneamino]-2-hydroxy-3,5-di(propan-2-yl)benzamide |
|---|---|
| PubChem CID | 4581452 |
| Molecular Formula | C22H26N2O4 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.19 |
| IUPAC Name | N-[1-(1,3-benzodioxol-5-yl)ethylideneamino]-2-hydroxy-3,5-di(propan-2-yl)benzamide |
| SMILES | CC(=NNC(=O)c1cc(C(C)C)cc(C(C)C)c1O)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C22H26N2O4/c1-12(2)16-8-17(13(3)4)21(25)18(9-16)22(26)24-23-14(5)15-6-7-19-20(10-15)28-11-27-19/h6-10,12-13,25H,11H2,1-5H3,(H,24,26) |
| InChIKey | QHHRVODNKBPDMN-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 80.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|