C13H16N4O3S — CID 4583927
2-(2-aminophenyl)-2-(morpholine-4-carbothioylhydrazinylidene)acetic acid (PubChem CID 4583927) has the molecular formula C13H16N4O3S and a molecular weight of 308.36 g/mol. Its IUPAC name is 2-(2-aminophenyl)-2-(morpholine-4-carbothioylhydrazinylidene)acetic acid.
| Compound Name | 2-(2-aminophenyl)-2-(morpholine-4-carbothioylhydrazinylidene)acetic acid |
|---|---|
| PubChem CID | 4583927 |
| Molecular Formula | C13H16N4O3S |
| Molecular Weight | 308.36 g/mol |
| Exact Mass | 308.09 |
| IUPAC Name | 2-(2-aminophenyl)-2-(morpholine-4-carbothioylhydrazinylidene)acetic acid |
| SMILES | Nc1ccccc1C(=NNC(=S)N1CCOCC1)C(=O)O |
| InChI | InChI=1S/C13H16N4O3S/c14-10-4-2-1-3-9(10)11(12(18)19)15-16-13(21)17-5-7-20-8-6-17/h1-4H,5-8,14H2,(H,16,21)(H,18,19) |
| InChIKey | UBDNVQCJUWUIOZ-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 100.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.36 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|