C23H20N2O2S — CID 4585301
4-[3,5-bis(phenylmethoxy)phenyl]-1,3-thiazol-2-amine (PubChem CID 4585301) has the molecular formula C23H20N2O2S and a molecular weight of 388.49 g/mol. Its IUPAC name is 4-[3,5-bis(phenylmethoxy)phenyl]-1,3-thiazol-2-amine.
| Compound Name | 4-[3,5-bis(phenylmethoxy)phenyl]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 4585301 |
| Molecular Formula | C23H20N2O2S |
| Molecular Weight | 388.49 g/mol |
| Exact Mass | 388.12 |
| IUPAC Name | 4-[3,5-bis(phenylmethoxy)phenyl]-1,3-thiazol-2-amine |
| SMILES | Nc1nc(-c2cc(OCc3ccccc3)cc(OCc3ccccc3)c2)cs1 |
| InChI | InChI=1S/C23H20N2O2S/c24-23-25-22(16-28-23)19-11-20(26-14-17-7-3-1-4-8-17)13-21(12-19)27-15-18-9-5-2-6-10-18/h1-13,16H,14-15H2,(H2,24,25) |
| InChIKey | CAMJLLKLARFBGQ-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 57.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.49 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |