C22H26ClN5O4 — CID 4585365
7-(3-chloro-4-ethoxyphenyl)-6-(3-ethoxypropyl)-2,4-dimethylpurino[7,8-a]imidazole-1,3-dione (PubChem CID 4585365) has the molecular formula C22H26ClN5O4 and a molecular weight of 459.93 g/mol. Its IUPAC name is 7-(3-chloro-4-ethoxyphenyl)-6-(3-ethoxypropyl)-2,4-dimethylpurino[7,8-a]imidazole-1,3-dione.
| Compound Name | 7-(3-chloro-4-ethoxyphenyl)-6-(3-ethoxypropyl)-2,4-dimethylpurino[7,8-a]imidazole-1,3-dione |
|---|---|
| PubChem CID | 4585365 |
| Molecular Formula | C22H26ClN5O4 |
| Molecular Weight | 459.93 g/mol |
| Exact Mass | 459.17 |
| IUPAC Name | 7-(3-chloro-4-ethoxyphenyl)-6-(3-ethoxypropyl)-2,4-dimethylpurino[7,8-a]imidazole-1,3-dione |
| SMILES | CCOCCCn1c(-c2ccc(OCC)c(Cl)c2)cn2c3c(=O)n(C)c(=O)n(C)c3nc12 |
| InChI | InChI=1S/C22H26ClN5O4/c1-5-31-11-7-10-27-16(14-8-9-17(32-6-2)15(23)12-14)13-28-18-19(24-21(27)28)25(3)22(30)26(4)20(18)29/h8-9,12-13H,5-7,10-11H2,1-4H3 |
| InChIKey | UMHLISVOBWWZMO-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 84.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.93 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|