C31H30N2O4 — CID 4589361
6-ethenyl-7-[2-(2-hydroxyethoxy)phenyl]-2-(4-methylanilino)-7a-phenyl-4,7-dihydro-3aH-isoindole-1,3-dione (PubChem CID 4589361) has the molecular formula C31H30N2O4 and a molecular weight of 494.59 g/mol. Its IUPAC name is 6-ethenyl-7-[2-(2-hydroxyethoxy)phenyl]-2-(4-methylanilino)-7a-phenyl-4,7-dihydro-3aH-isoindole-1,3-dione.
| Compound Name | 6-ethenyl-7-[2-(2-hydroxyethoxy)phenyl]-2-(4-methylanilino)-7a-phenyl-4,7-dihydro-3aH-isoindole-1,3-dione |
|---|---|
| PubChem CID | 4589361 |
| Molecular Formula | C31H30N2O4 |
| Molecular Weight | 494.59 g/mol |
| Exact Mass | 494.22 |
| IUPAC Name | 6-ethenyl-7-[2-(2-hydroxyethoxy)phenyl]-2-(4-methylanilino)-7a-phenyl-4,7-dihydro-3aH-isoindole-1,3-dione |
| SMILES | C=CC1=CCC2C(=O)N(Nc3ccc(C)cc3)C(=O)C2(c2ccccc2)C1c1ccccc1OCCO |
| InChI | InChI=1S/C31H30N2O4/c1-3-22-15-18-26-29(35)33(32-24-16-13-21(2)14-17-24)30(36)31(26,23-9-5-4-6-10-23)28(22)25-11-7-8-12-27(25)37-20-19-34/h3-17,26,28,32,34H,1,18-20H2,2H3 |
| InChIKey | IHEBWMYGNOHSBH-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.59 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|