C29H26N2O3 — CID 4129003
6-ethenyl-7-(2-hydroxyphenyl)-2-(4-methylanilino)-7a-phenyl-4,7-dihydro-3aH-isoindole-1,3-dione (PubChem CID 4129003) has the molecular formula C29H26N2O3 and a molecular weight of 450.54 g/mol. Its IUPAC name is 6-ethenyl-7-(2-hydroxyphenyl)-2-(4-methylanilino)-7a-phenyl-4,7-dihydro-3aH-isoindole-1,3-dione.
| Compound Name | 6-ethenyl-7-(2-hydroxyphenyl)-2-(4-methylanilino)-7a-phenyl-4,7-dihydro-3aH-isoindole-1,3-dione |
|---|---|
| PubChem CID | 4129003 |
| Molecular Formula | C29H26N2O3 |
| Molecular Weight | 450.54 g/mol |
| Exact Mass | 450.19 |
| IUPAC Name | 6-ethenyl-7-(2-hydroxyphenyl)-2-(4-methylanilino)-7a-phenyl-4,7-dihydro-3aH-isoindole-1,3-dione |
| SMILES | C=CC1=CCC2C(=O)N(Nc3ccc(C)cc3)C(=O)C2(c2ccccc2)C1c1ccccc1O |
| InChI | InChI=1S/C29H26N2O3/c1-3-20-15-18-24-27(33)31(30-22-16-13-19(2)14-17-22)28(34)29(24,21-9-5-4-6-10-21)26(20)23-11-7-8-12-25(23)32/h3-17,24,26,30,32H,1,18H2,2H3 |
| InChIKey | FBTIALHXQHIFLJ-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.54 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|