C19H28N2O4 — CID 4589828
2-[[2-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]acetyl]hydrazinylidene]propanoic acid (PubChem CID 4589828) has the molecular formula C19H28N2O4 and a molecular weight of 348.44 g/mol. Its IUPAC name is 2-[[2-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]acetyl]hydrazinylidene]propanoic acid.
| Compound Name | 2-[[2-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]acetyl]hydrazinylidene]propanoic acid |
|---|---|
| PubChem CID | 4589828 |
| Molecular Formula | C19H28N2O4 |
| Molecular Weight | 348.44 g/mol |
| Exact Mass | 348.20 |
| IUPAC Name | 2-[[2-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]acetyl]hydrazinylidene]propanoic acid |
| SMILES | CC(=NNC(=O)COc1ccc(C(C)(C)CC(C)(C)C)cc1)C(=O)O |
| InChI | InChI=1S/C19H28N2O4/c1-13(17(23)24)20-21-16(22)11-25-15-9-7-14(8-10-15)19(5,6)12-18(2,3)4/h7-10H,11-12H2,1-6H3,(H,21,22)(H,23,24) |
| InChIKey | AFBKTLQOJMZBPP-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 87.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.44 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|