C16H13FN2O2 — CID 4591992
N-[4-(4,5-dihydro-1,3-oxazol-2-yl)phenyl]-3-fluorobenzamide (PubChem CID 4591992) has the molecular formula C16H13FN2O2 and a molecular weight of 284.29 g/mol. Its IUPAC name is N-[4-(4,5-dihydro-1,3-oxazol-2-yl)phenyl]-3-fluorobenzamide.
| Compound Name | N-[4-(4,5-dihydro-1,3-oxazol-2-yl)phenyl]-3-fluorobenzamide |
|---|---|
| PubChem CID | 4591992 |
| Molecular Formula | C16H13FN2O2 |
| Molecular Weight | 284.29 g/mol |
| Exact Mass | 284.10 |
| IUPAC Name | N-[4-(4,5-dihydro-1,3-oxazol-2-yl)phenyl]-3-fluorobenzamide |
| SMILES | O=C(Nc1ccc(C2=NCCO2)cc1)c1cccc(F)c1 |
| InChI | InChI=1S/C16H13FN2O2/c17-13-3-1-2-12(10-13)15(20)19-14-6-4-11(5-7-14)16-18-8-9-21-16/h1-7,10H,8-9H2,(H,19,20) |
| InChIKey | RNHUPLFEWIWAHC-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.29 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |