C16H13ClN2O3 — CID 4598419
4-(4-chlorophenyl)-8-methyl-4,8-diazatricyclo[5.2.2.02,6]undec-10-ene-3,5,9-trione (PubChem CID 4598419) has the molecular formula C16H13ClN2O3 and a molecular weight of 316.74 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-8-methyl-4,8-diazatricyclo[5.2.2.02,6]undec-10-ene-3,5,9-trione.
| Compound Name | 4-(4-chlorophenyl)-8-methyl-4,8-diazatricyclo[5.2.2.02,6]undec-10-ene-3,5,9-trione |
|---|---|
| PubChem CID | 4598419 |
| Molecular Formula | C16H13ClN2O3 |
| Molecular Weight | 316.74 g/mol |
| Exact Mass | 316.06 |
| IUPAC Name | 4-(4-chlorophenyl)-8-methyl-4,8-diazatricyclo[5.2.2.02,6]undec-10-ene-3,5,9-trione |
| SMILES | CN1C(=O)C2C=CC1C1C(=O)N(c3ccc(Cl)cc3)C(=O)C21 |
| InChI | InChI=1S/C16H13ClN2O3/c1-18-11-7-6-10(14(18)20)12-13(11)16(22)19(15(12)21)9-4-2-8(17)3-5-9/h2-7,10-13H,1H3 |
| InChIKey | MFEUXHBQSOBVEH-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.74 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|