C17H12BrF3N2O3 — CID 68541722
(1R,2R,6R,7S)-4-[4-bromo-3-(trifluoromethyl)phenyl]-8-methyl-4,8-diazatricyclo[5.2.2.02,6]undec-10-ene-3,5,9-trione (PubChem CID 68541722) has the molecular formula C17H12BrF3N2O3 and a molecular weight of 429.19 g/mol. Its IUPAC name is (1R,2R,6R,7S)-4-[4-bromo-3-(trifluoromethyl)phenyl]-8-methyl-4,8-diazatricyclo[5.2.2.02,6]undec-10-ene-3,5,9-trione.
| Compound Name | (1R,2R,6R,7S)-4-[4-bromo-3-(trifluoromethyl)phenyl]-8-methyl-4,8-diazatricyclo[5.2.2.02,6]undec-10-ene-3,5,9-trione |
|---|---|
| PubChem CID | 68541722 |
| Molecular Formula | C17H12BrF3N2O3 |
| Molecular Weight | 429.19 g/mol |
| Exact Mass | 428.00 |
| IUPAC Name | (1R,2R,6R,7S)-4-[4-bromo-3-(trifluoromethyl)phenyl]-8-methyl-4,8-diazatricyclo[5.2.2.02,6]undec-10-ene-3,5,9-trione |
| SMILES | CN1C(=O)[C@@H]2C=C[C@H]1[C@@H]1C(=O)N(c3ccc(Br)c(C(F)(F)F)c3)C(=O)[C@@H]12 |
| InChI | InChI=1S/C17H12BrF3N2O3/c1-22-11-5-3-8(14(22)24)12-13(11)16(26)23(15(12)25)7-2-4-10(18)9(6-7)17(19,20)21/h2-6,8,11-13H,1H3/t8-,11+,12-,13+/m1/s1 |
| InChIKey | KIGPIBWRPJACBP-NZBQSGDWSA-N |
| XLogP | 2.60 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.19 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|