C23H25NO9S — CID 4598629
diethyl 5-[(3-ethoxycarbonylphenyl)-methylsulfonylcarbamoyl]benzene-1,3-dicarboxylate (PubChem CID 4598629) has the molecular formula C23H25NO9S and a molecular weight of 491.52 g/mol. Its IUPAC name is diethyl 5-[(3-ethoxycarbonylphenyl)-methylsulfonylcarbamoyl]benzene-1,3-dicarboxylate.
| Compound Name | diethyl 5-[(3-ethoxycarbonylphenyl)-methylsulfonylcarbamoyl]benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 4598629 |
| Molecular Formula | C23H25NO9S |
| Molecular Weight | 491.52 g/mol |
| Exact Mass | 491.13 |
| IUPAC Name | diethyl 5-[(3-ethoxycarbonylphenyl)-methylsulfonylcarbamoyl]benzene-1,3-dicarboxylate |
| SMILES | CCOC(=O)c1cc(C(=O)OCC)cc(C(=O)N(c2cccc(C(=O)OCC)c2)S(C)(=O)=O)c1 |
| InChI | InChI=1S/C23H25NO9S/c1-5-31-21(26)15-9-8-10-19(14-15)24(34(4,29)30)20(25)16-11-17(22(27)32-6-2)13-18(12-16)23(28)33-7-3/h8-14H,5-7H2,1-4H3 |
| InChIKey | QYMROEJJLYHHII-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 133.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.52 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|