C17H21NO5S — CID 5019901
ethyl 3-[(2-cyclopent-2-en-1-ylacetyl)-methylsulfonylamino]benzoate (PubChem CID 5019901) has the molecular formula C17H21NO5S and a molecular weight of 351.42 g/mol. Its IUPAC name is ethyl 3-[(2-cyclopent-2-en-1-ylacetyl)-methylsulfonylamino]benzoate.
| Compound Name | ethyl 3-[(2-cyclopent-2-en-1-ylacetyl)-methylsulfonylamino]benzoate |
|---|---|
| PubChem CID | 5019901 |
| Molecular Formula | C17H21NO5S |
| Molecular Weight | 351.42 g/mol |
| Exact Mass | 351.11 |
| IUPAC Name | ethyl 3-[(2-cyclopent-2-en-1-ylacetyl)-methylsulfonylamino]benzoate |
| SMILES | CCOC(=O)c1cccc(N(C(=O)CC2C=CCC2)S(C)(=O)=O)c1 |
| InChI | InChI=1S/C17H21NO5S/c1-3-23-17(20)14-9-6-10-15(12-14)18(24(2,21)22)16(19)11-13-7-4-5-8-13/h4,6-7,9-10,12-13H,3,5,8,11H2,1-2H3 |
| InChIKey | BBDJGDLPYGUXFT-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.42 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|