C23H29N3O4 — CID 46019645
N-[1-[1-(furan-2-carbonyl)piperidin-4-yl]-2-oxo-2-(propylamino)ethyl]-2-methylbenzamide (PubChem CID 46019645) has the molecular formula C23H29N3O4 and a molecular weight of 411.50 g/mol. Its IUPAC name is N-[1-[1-(furan-2-carbonyl)piperidin-4-yl]-2-oxo-2-(propylamino)ethyl]-2-methylbenzamide.
| Compound Name | N-[1-[1-(furan-2-carbonyl)piperidin-4-yl]-2-oxo-2-(propylamino)ethyl]-2-methylbenzamide |
|---|---|
| PubChem CID | 46019645 |
| Molecular Formula | C23H29N3O4 |
| Molecular Weight | 411.50 g/mol |
| Exact Mass | 411.22 |
| IUPAC Name | N-[1-[1-(furan-2-carbonyl)piperidin-4-yl]-2-oxo-2-(propylamino)ethyl]-2-methylbenzamide |
| SMILES | CCCNC(=O)C(NC(=O)c1ccccc1C)C1CCN(C(=O)c2ccco2)CC1 |
| InChI | InChI=1S/C23H29N3O4/c1-3-12-24-22(28)20(25-21(27)18-8-5-4-7-16(18)2)17-10-13-26(14-11-17)23(29)19-9-6-15-30-19/h4-9,15,17,20H,3,10-14H2,1-2H3,(H,24,28)(H,25,27) |
| InChIKey | DCMSCYGNGMAKPN-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 91.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.50 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |